About (1-acetylpiperidin-4-yl) 2-(pyridin-3-yloxymethyl)piperidine-1-carboxylate
(1-acetylpiperidin-4-yl) 2-(pyridin-3-yloxymethyl)piperidine-1-carboxylate (PubChem CID 158554982) has the molecular formula C19H27N3O4
and a molecular weight of 361.44 g/mol. Its IUPAC name is (1-acetylpiperidin-4-yl) 2-(pyridin-3-yloxymethyl)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | (1-acetylpiperidin-4-yl) 2-(pyridin-3-yloxymethyl)piperidine-1-carboxylate |
| PubChem CID | 158554982 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | (1-acetylpiperidin-4-yl) 2-(pyridin-3-yloxymethyl)piperidine-1-carboxylate |
| SMILES | CC(=O)N1CCC(OC(=O)N2CCCCC2COc2cccnc2)CC1 |
| InChI | InChI=1S/C19H27N3O4/c1-15(23)21-11-7-17(8-12-21)26-19(24)22-10-3-2-5-16(22)14-25-18-6-4-9-20-13-18/h4,6,9,13,16-17H,2-3,5,7-8,10-12,14H2,1H3 |
| InChIKey | STYLIMSYYVEMJR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1-acetylpiperidin-4-yl) 2-(pyridin-3-yloxymethyl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-acetylpiperidin-4-yl) 2-(pyridin-3-yloxymethyl)piperidine-1-carboxylate?
The IUPAC name of (1-acetylpiperidin-4-yl) 2-(pyridin-3-yloxymethyl)piperidine-1-carboxylate (CID 158554982) is (1-acetylpiperidin-4-yl) 2-(pyridin-3-yloxymethyl)piperidine-1-carboxylate.
What is the SMILES notation for (1-acetylpiperidin-4-yl) 2-(pyridin-3-yloxymethyl)piperidine-1-carboxylate?
The canonical SMILES for (1-acetylpiperidin-4-yl) 2-(pyridin-3-yloxymethyl)piperidine-1-carboxylate is CC(=O)N1CCC(OC(=O)N2CCCCC2COc2cccnc2)CC1.
What is the InChIKey of (1-acetylpiperidin-4-yl) 2-(pyridin-3-yloxymethyl)piperidine-1-carboxylate?
The InChIKey is STYLIMSYYVEMJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27N3O4/c1-15(23)21-11-7-17(8-12-21)26-19(24)22-10-3-2-5-16(22)14-25-18-6-4-9-20-13-18/h4,6,9,13,16-17H,2-3,5,7-8,10-12,14H2,1H3.
What are the key properties of (1-acetylpiperidin-4-yl) 2-(pyridin-3-yloxymethyl)piperidine-1-carboxylate?
(1-acetylpiperidin-4-yl) 2-(pyridin-3-yloxymethyl)piperidine-1-carboxylate has a molecular weight of 361.44 g/mol, XLogP of 2.46, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-acetylpiperidin-4-yl) 2-(pyridin-3-yloxymethyl)piperidine-1-carboxylate is sourced from PubChem (CID 158554982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).