About ethyl [(2-fluoro-4-nitrophenyl)-methyl-nitroso-λ4-sulfanyl]formate
ethyl [(2-fluoro-4-nitrophenyl)-methyl-nitroso-λ4-sulfanyl]formate (PubChem CID 87598940) has the molecular formula C10H11FN2O5S
and a molecular weight of 290.27 g/mol. Its IUPAC name is ethyl [(2-fluoro-4-nitrophenyl)-methyl-nitroso-λ4-sulfanyl]formate.
Molecular Properties
| Compound Name | ethyl [(2-fluoro-4-nitrophenyl)-methyl-nitroso-λ4-sulfanyl]formate |
| PubChem CID | 87598940 |
| Molecular Formula | C10H11FN2O5S |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | ethyl [(2-fluoro-4-nitrophenyl)-methyl-nitroso-λ4-sulfanyl]formate |
| SMILES | CCOC(=O)S(C)(N=O)c1ccc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C10H11FN2O5S/c1-3-18-10(14)19(2,12-15)9-5-4-7(13(16)17)6-8(9)11/h4-6H,3H2,1-2H3 |
| InChIKey | UOYQBFFZPWMVQL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 98.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze ethyl [(2-fluoro-4-nitrophenyl)-methyl-nitroso-λ4-sulfanyl]formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl [(2-fluoro-4-nitrophenyl)-methyl-nitroso-λ4-sulfanyl]formate?
The IUPAC name of ethyl [(2-fluoro-4-nitrophenyl)-methyl-nitroso-λ4-sulfanyl]formate (CID 87598940) is ethyl [(2-fluoro-4-nitrophenyl)-methyl-nitroso-λ4-sulfanyl]formate.
What is the SMILES notation for ethyl [(2-fluoro-4-nitrophenyl)-methyl-nitroso-λ4-sulfanyl]formate?
The canonical SMILES for ethyl [(2-fluoro-4-nitrophenyl)-methyl-nitroso-λ4-sulfanyl]formate is CCOC(=O)S(C)(N=O)c1ccc([N+](=O)[O-])cc1F.
What is the InChIKey of ethyl [(2-fluoro-4-nitrophenyl)-methyl-nitroso-λ4-sulfanyl]formate?
The InChIKey is UOYQBFFZPWMVQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FN2O5S/c1-3-18-10(14)19(2,12-15)9-5-4-7(13(16)17)6-8(9)11/h4-6H,3H2,1-2H3.
What are the key properties of ethyl [(2-fluoro-4-nitrophenyl)-methyl-nitroso-λ4-sulfanyl]formate?
ethyl [(2-fluoro-4-nitrophenyl)-methyl-nitroso-λ4-sulfanyl]formate has a molecular weight of 290.27 g/mol, XLogP of 3.37, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl [(2-fluoro-4-nitrophenyl)-methyl-nitroso-λ4-sulfanyl]formate is sourced from PubChem (CID 87598940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).