About 1-ethyl-3-[(2-fluoro-4-nitrophenyl)-methylidene-oxo-λ6-sulfanyl]urea
1-ethyl-3-[(2-fluoro-4-nitrophenyl)-methylidene-oxo-λ6-sulfanyl]urea (PubChem CID 91508875) has the molecular formula C10H12FN3O4S
and a molecular weight of 289.29 g/mol. Its IUPAC name is 1-ethyl-3-[(2-fluoro-4-nitrophenyl)-methylidene-oxo-λ6-sulfanyl]urea.
Molecular Properties
| Compound Name | 1-ethyl-3-[(2-fluoro-4-nitrophenyl)-methylidene-oxo-λ6-sulfanyl]urea |
| PubChem CID | 91508875 |
| Molecular Formula | C10H12FN3O4S |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 1-ethyl-3-[(2-fluoro-4-nitrophenyl)-methylidene-oxo-λ6-sulfanyl]urea |
| SMILES | C=S(=O)(NC(=O)NCC)c1ccc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C10H12FN3O4S/c1-3-12-10(15)13-19(2,18)9-5-4-7(14(16)17)6-8(9)11/h4-6H,2-3H2,1H3,(H2,12,13,15,18) |
| InChIKey | FVVSUXYTBPVOQJ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3-[(2-fluoro-4-nitrophenyl)-methylidene-oxo-λ6-sulfanyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-[(2-fluoro-4-nitrophenyl)-methylidene-oxo-λ6-sulfanyl]urea?
The IUPAC name of 1-ethyl-3-[(2-fluoro-4-nitrophenyl)-methylidene-oxo-λ6-sulfanyl]urea (CID 91508875) is 1-ethyl-3-[(2-fluoro-4-nitrophenyl)-methylidene-oxo-λ6-sulfanyl]urea.
What is the SMILES notation for 1-ethyl-3-[(2-fluoro-4-nitrophenyl)-methylidene-oxo-λ6-sulfanyl]urea?
The canonical SMILES for 1-ethyl-3-[(2-fluoro-4-nitrophenyl)-methylidene-oxo-λ6-sulfanyl]urea is C=S(=O)(NC(=O)NCC)c1ccc([N+](=O)[O-])cc1F.
What is the InChIKey of 1-ethyl-3-[(2-fluoro-4-nitrophenyl)-methylidene-oxo-λ6-sulfanyl]urea?
The InChIKey is FVVSUXYTBPVOQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12FN3O4S/c1-3-12-10(15)13-19(2,18)9-5-4-7(14(16)17)6-8(9)11/h4-6H,2-3H2,1H3,(H2,12,13,15,18).
What are the key properties of 1-ethyl-3-[(2-fluoro-4-nitrophenyl)-methylidene-oxo-λ6-sulfanyl]urea?
1-ethyl-3-[(2-fluoro-4-nitrophenyl)-methylidene-oxo-λ6-sulfanyl]urea has a molecular weight of 289.29 g/mol, XLogP of 1.04, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-[(2-fluoro-4-nitrophenyl)-methylidene-oxo-λ6-sulfanyl]urea is sourced from PubChem (CID 91508875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).