C10H12FN3O4S — CID 91508875
1-ethyl-3-[(2-fluoro-4-nitrophenyl)-methylidene-oxo-λ6-sulfanyl]urea (PubChem CID 91508875) has the molecular formula C10H12FN3O4S and a molecular weight of 289.29 g/mol. Its IUPAC name is 1-ethyl-3-[(2-fluoro-4-nitrophenyl)-methylidene-oxo-λ6-sulfanyl]urea.
| Compound Name | 1-ethyl-3-[(2-fluoro-4-nitrophenyl)-methylidene-oxo-λ6-sulfanyl]urea |
|---|---|
| PubChem CID | 91508875 |
| Molecular Formula | C10H12FN3O4S |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 1-ethyl-3-[(2-fluoro-4-nitrophenyl)-methylidene-oxo-λ6-sulfanyl]urea |
| SMILES | C=S(=O)(NC(=O)NCC)c1ccc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C10H12FN3O4S/c1-3-12-10(15)13-19(2,18)9-5-4-7(14(16)17)6-8(9)11/h4-6H,2-3H2,1H3,(H2,12,13,15,18) |
| InChIKey | FVVSUXYTBPVOQJ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|