C22H25FN2O5 — CID 87601539
3-[2-(6-benzyl-2-oxo-1H-pyridin-3-yl)pentanoylamino]-5-fluoro-4-oxopentanoic acid (PubChem CID 87601539) has the molecular formula C22H25FN2O5 and a molecular weight of 416.45 g/mol. Its IUPAC name is 3-[2-(6-benzyl-2-oxo-1H-pyridin-3-yl)pentanoylamino]-5-fluoro-4-oxopentanoic acid.
| Compound Name | 3-[2-(6-benzyl-2-oxo-1H-pyridin-3-yl)pentanoylamino]-5-fluoro-4-oxopentanoic acid |
|---|---|
| PubChem CID | 87601539 |
| Molecular Formula | C22H25FN2O5 |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 3-[2-(6-benzyl-2-oxo-1H-pyridin-3-yl)pentanoylamino]-5-fluoro-4-oxopentanoic acid |
| SMILES | CCCC(C(=O)NC(CC(=O)O)C(=O)CF)c1ccc(Cc2ccccc2)[nH]c1=O |
| InChI | InChI=1S/C22H25FN2O5/c1-2-6-16(22(30)25-18(12-20(27)28)19(26)13-23)17-10-9-15(24-21(17)29)11-14-7-4-3-5-8-14/h3-5,7-10,16,18H,2,6,11-13H2,1H3,(H,24,29)(H,25,30)(H,27,28) |
| InChIKey | ISNYWFFAKAZOEH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |