C19H21N3O5 — CID 22881967
(3S)-3-[[(2S)-2-[(5-benzyl-1H-pyrrole-2-carbonyl)amino]propanoyl]amino]-4-oxobutanoic acid (PubChem CID 22881967) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is (3S)-3-[[(2S)-2-[(5-benzyl-1H-pyrrole-2-carbonyl)amino]propanoyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[[(2S)-2-[(5-benzyl-1H-pyrrole-2-carbonyl)amino]propanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22881967 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | (3S)-3-[[(2S)-2-[(5-benzyl-1H-pyrrole-2-carbonyl)amino]propanoyl]amino]-4-oxobutanoic acid |
| SMILES | C[C@H](NC(=O)c1ccc(Cc2ccccc2)[nH]1)C(=O)N[C@H](C=O)CC(=O)O |
| InChI | InChI=1S/C19H21N3O5/c1-12(18(26)22-15(11-23)10-17(24)25)20-19(27)16-8-7-14(21-16)9-13-5-3-2-4-6-13/h2-8,11-12,15,21H,9-10H2,1H3,(H,20,27)(H,22,26)(H,24,25)/t12-,15-/m0/s1 |
| InChIKey | WHGGLAKQLJIFQY-WFASDCNBSA-N |
| XLogP | 0.88 |
| TPSA | 128.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|