C23H26N4O7S — CID 11649056
N-(2-benzylphenyl)-N'-[1-[[4-(methanesulfonamido)-1,4-dioxobutan-2-yl]amino]-1-oxopropan-2-yl]oxamide (PubChem CID 11649056) has the molecular formula C23H26N4O7S and a molecular weight of 502.55 g/mol. Its IUPAC name is N-(2-benzylphenyl)-N'-[1-[[4-(methanesulfonamido)-1,4-dioxobutan-2-yl]amino]-1-oxopropan-2-yl]oxamide.
| Compound Name | N-(2-benzylphenyl)-N'-[1-[[4-(methanesulfonamido)-1,4-dioxobutan-2-yl]amino]-1-oxopropan-2-yl]oxamide |
|---|---|
| PubChem CID | 11649056 |
| Molecular Formula | C23H26N4O7S |
| Molecular Weight | 502.55 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | N-(2-benzylphenyl)-N'-[1-[[4-(methanesulfonamido)-1,4-dioxobutan-2-yl]amino]-1-oxopropan-2-yl]oxamide |
| SMILES | CC(NC(=O)C(=O)Nc1ccccc1Cc1ccccc1)C(=O)NC(C=O)CC(=O)NS(C)(=O)=O |
| InChI | InChI=1S/C23H26N4O7S/c1-15(21(30)25-18(14-28)13-20(29)27-35(2,33)34)24-22(31)23(32)26-19-11-7-6-10-17(19)12-16-8-4-3-5-9-16/h3-11,14-15,18H,12-13H2,1-2H3,(H,24,31)(H,25,30)(H,26,32)(H,27,29) |
| InChIKey | PWTMUNXPOMKKCT-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 167.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.55 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|