C24H28N4O7S — CID 11519175
N-(2-benzylphenyl)-N'-[1-[[5-(methanesulfonamido)-1,5-dioxopentan-2-yl]amino]-1-oxopropan-2-yl]oxamide (PubChem CID 11519175) has the molecular formula C24H28N4O7S and a molecular weight of 516.58 g/mol. Its IUPAC name is N-(2-benzylphenyl)-N'-[1-[[5-(methanesulfonamido)-1,5-dioxopentan-2-yl]amino]-1-oxopropan-2-yl]oxamide.
| Compound Name | N-(2-benzylphenyl)-N'-[1-[[5-(methanesulfonamido)-1,5-dioxopentan-2-yl]amino]-1-oxopropan-2-yl]oxamide |
|---|---|
| PubChem CID | 11519175 |
| Molecular Formula | C24H28N4O7S |
| Molecular Weight | 516.58 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | N-(2-benzylphenyl)-N'-[1-[[5-(methanesulfonamido)-1,5-dioxopentan-2-yl]amino]-1-oxopropan-2-yl]oxamide |
| SMILES | CC(NC(=O)C(=O)Nc1ccccc1Cc1ccccc1)C(=O)NC(C=O)CCC(=O)NS(C)(=O)=O |
| InChI | InChI=1S/C24H28N4O7S/c1-16(22(31)26-19(15-29)12-13-21(30)28-36(2,34)35)25-23(32)24(33)27-20-11-7-6-10-18(20)14-17-8-4-3-5-9-17/h3-11,15-16,19H,12-14H2,1-2H3,(H,25,32)(H,26,31)(H,27,33)(H,28,30) |
| InChIKey | LITXMNZXHYHGOA-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 167.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.58 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|