C18H24N4O6S — CID 11495547
N-benzyl-N'-[1-[[5-(methanesulfinamido)-1,5-dioxopentan-2-yl]amino]-1-oxopropan-2-yl]oxamide (PubChem CID 11495547) has the molecular formula C18H24N4O6S and a molecular weight of 424.48 g/mol. Its IUPAC name is N-benzyl-N'-[1-[[5-(methanesulfinamido)-1,5-dioxopentan-2-yl]amino]-1-oxopropan-2-yl]oxamide.
| Compound Name | N-benzyl-N'-[1-[[5-(methanesulfinamido)-1,5-dioxopentan-2-yl]amino]-1-oxopropan-2-yl]oxamide |
|---|---|
| PubChem CID | 11495547 |
| Molecular Formula | C18H24N4O6S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | N-benzyl-N'-[1-[[5-(methanesulfinamido)-1,5-dioxopentan-2-yl]amino]-1-oxopropan-2-yl]oxamide |
| SMILES | CC(NC(=O)C(=O)NCc1ccccc1)C(=O)NC(C=O)CCC(=O)NS(C)=O |
| InChI | InChI=1S/C18H24N4O6S/c1-12(16(25)21-14(11-23)8-9-15(24)22-29(2)28)20-18(27)17(26)19-10-13-6-4-3-5-7-13/h3-7,11-12,14H,8-10H2,1-2H3,(H,19,26)(H,20,27)(H,21,25)(H,22,24) |
| InChIKey | KSVYSKSIJUMFLO-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 150.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|