C23H34N4O6S — CID 11555023
N-(2-tert-butylphenyl)-N'-[1-[[5-(methanesulfinamido)-1,5-dioxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]oxamide (PubChem CID 11555023) has the molecular formula C23H34N4O6S and a molecular weight of 494.61 g/mol. Its IUPAC name is N-(2-tert-butylphenyl)-N'-[1-[[5-(methanesulfinamido)-1,5-dioxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]oxamide.
| Compound Name | N-(2-tert-butylphenyl)-N'-[1-[[5-(methanesulfinamido)-1,5-dioxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]oxamide |
|---|---|
| PubChem CID | 11555023 |
| Molecular Formula | C23H34N4O6S |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | N-(2-tert-butylphenyl)-N'-[1-[[5-(methanesulfinamido)-1,5-dioxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]oxamide |
| SMILES | CC(C)C(NC(=O)C(=O)Nc1ccccc1C(C)(C)C)C(=O)NC(C=O)CCC(=O)NS(C)=O |
| InChI | InChI=1S/C23H34N4O6S/c1-14(2)19(20(30)24-15(13-28)11-12-18(29)27-34(6)33)26-22(32)21(31)25-17-10-8-7-9-16(17)23(3,4)5/h7-10,13-15,19H,11-12H2,1-6H3,(H,24,30)(H,25,31)(H,26,32)(H,27,29) |
| InChIKey | RWYQHBFAHOAJAQ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 150.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|