C20H28N2O5 — CID 87950501
(3S)-4-oxo-3-[[4-oxo-4-(3-phenylpropylamino)-2-propan-2-ylbutanoyl]amino]butanoic acid (PubChem CID 87950501) has the molecular formula C20H28N2O5 and a molecular weight of 376.45 g/mol. Its IUPAC name is (3S)-4-oxo-3-[[4-oxo-4-(3-phenylpropylamino)-2-propan-2-ylbutanoyl]amino]butanoic acid.
| Compound Name | (3S)-4-oxo-3-[[4-oxo-4-(3-phenylpropylamino)-2-propan-2-ylbutanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 87950501 |
| Molecular Formula | C20H28N2O5 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | (3S)-4-oxo-3-[[4-oxo-4-(3-phenylpropylamino)-2-propan-2-ylbutanoyl]amino]butanoic acid |
| SMILES | CC(C)C(CC(=O)NCCCc1ccccc1)C(=O)N[C@H](C=O)CC(=O)O |
| InChI | InChI=1S/C20H28N2O5/c1-14(2)17(20(27)22-16(13-23)11-19(25)26)12-18(24)21-10-6-9-15-7-4-3-5-8-15/h3-5,7-8,13-14,16-17H,6,9-12H2,1-2H3,(H,21,24)(H,22,27)(H,25,26)/t16-,17?/m0/s1 |
| InChIKey | SXYYPOZRVFSDMZ-BHWOMJMDSA-N |
| XLogP | 1.56 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|