C34H38N4O6 — CID 54398238
5-[3-(1H-imidazol-2-yl)naphthalen-2-yl]oxy-4-oxo-3-[[4-oxo-4-(3-phenylpropylamino)-2-propan-2-ylbutanoyl]amino]pentanoic acid (PubChem CID 54398238) has the molecular formula C34H38N4O6 and a molecular weight of 598.70 g/mol. Its IUPAC name is 5-[3-(1H-imidazol-2-yl)naphthalen-2-yl]oxy-4-oxo-3-[[4-oxo-4-(3-phenylpropylamino)-2-propan-2-ylbutanoyl]amino]pentanoic acid.
| Compound Name | 5-[3-(1H-imidazol-2-yl)naphthalen-2-yl]oxy-4-oxo-3-[[4-oxo-4-(3-phenylpropylamino)-2-propan-2-ylbutanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 54398238 |
| Molecular Formula | C34H38N4O6 |
| Molecular Weight | 598.70 g/mol |
| Exact Mass | 598.28 |
| IUPAC Name | 5-[3-(1H-imidazol-2-yl)naphthalen-2-yl]oxy-4-oxo-3-[[4-oxo-4-(3-phenylpropylamino)-2-propan-2-ylbutanoyl]amino]pentanoic acid |
| SMILES | CC(C)C(CC(=O)NCCCc1ccccc1)C(=O)NC(CC(=O)O)C(=O)COc1cc2ccccc2cc1-c1ncc[nH]1 |
| InChI | InChI=1S/C34H38N4O6/c1-22(2)26(19-31(40)35-14-8-11-23-9-4-3-5-10-23)34(43)38-28(20-32(41)42)29(39)21-44-30-18-25-13-7-6-12-24(25)17-27(30)33-36-15-16-37-33/h3-7,9-10,12-13,15-18,22,26,28H,8,11,14,19-21H2,1-2H3,(H,35,40)(H,36,37)(H,38,43)(H,41,42) |
| InChIKey | VLNYIOYVRRRCER-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 150.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.70 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|