C30H34N2O8 — CID 54020610
4-oxo-5-(2-oxochromen-6-yl)oxy-3-[[4-oxo-4-(3-phenylpropylamino)-2-propan-2-ylbutanoyl]amino]pentanoic acid (PubChem CID 54020610) has the molecular formula C30H34N2O8 and a molecular weight of 550.61 g/mol. Its IUPAC name is 4-oxo-5-(2-oxochromen-6-yl)oxy-3-[[4-oxo-4-(3-phenylpropylamino)-2-propan-2-ylbutanoyl]amino]pentanoic acid.
| Compound Name | 4-oxo-5-(2-oxochromen-6-yl)oxy-3-[[4-oxo-4-(3-phenylpropylamino)-2-propan-2-ylbutanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 54020610 |
| Molecular Formula | C30H34N2O8 |
| Molecular Weight | 550.61 g/mol |
| Exact Mass | 550.23 |
| IUPAC Name | 4-oxo-5-(2-oxochromen-6-yl)oxy-3-[[4-oxo-4-(3-phenylpropylamino)-2-propan-2-ylbutanoyl]amino]pentanoic acid |
| SMILES | CC(C)C(CC(=O)NCCCc1ccccc1)C(=O)NC(CC(=O)O)C(=O)COc1ccc2oc(=O)ccc2c1 |
| InChI | InChI=1S/C30H34N2O8/c1-19(2)23(16-27(34)31-14-6-9-20-7-4-3-5-8-20)30(38)32-24(17-28(35)36)25(33)18-39-22-11-12-26-21(15-22)10-13-29(37)40-26/h3-5,7-8,10-13,15,19,23-24H,6,9,14,16-18H2,1-2H3,(H,31,34)(H,32,38)(H,35,36) |
| InChIKey | KYRBICRKVFJCTO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 152.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.61 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|