C28H28N4O9 — CID 102106076
N-[6-hydrazinyl-6-oxo-5-[[2-(2-oxochromen-7-yl)oxyacetyl]amino]hexyl]-2-(2-oxochromen-7-yl)oxyacetamide (PubChem CID 102106076) has the molecular formula C28H28N4O9 and a molecular weight of 564.55 g/mol. Its IUPAC name is N-[6-hydrazinyl-6-oxo-5-[[2-(2-oxochromen-7-yl)oxyacetyl]amino]hexyl]-2-(2-oxochromen-7-yl)oxyacetamide.
| Compound Name | N-[6-hydrazinyl-6-oxo-5-[[2-(2-oxochromen-7-yl)oxyacetyl]amino]hexyl]-2-(2-oxochromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 102106076 |
| Molecular Formula | C28H28N4O9 |
| Molecular Weight | 564.55 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | N-[6-hydrazinyl-6-oxo-5-[[2-(2-oxochromen-7-yl)oxyacetyl]amino]hexyl]-2-(2-oxochromen-7-yl)oxyacetamide |
| SMILES | NNC(=O)C(CCCCNC(=O)COc1ccc2ccc(=O)oc2c1)NC(=O)COc1ccc2ccc(=O)oc2c1 |
| InChI | InChI=1S/C28H28N4O9/c29-32-28(37)21(31-25(34)16-39-20-9-5-18-7-11-27(36)41-23(18)14-20)3-1-2-12-30-24(33)15-38-19-8-4-17-6-10-26(35)40-22(17)13-19/h4-11,13-14,21H,1-3,12,15-16,29H2,(H,30,33)(H,31,34)(H,32,37) |
| InChIKey | KQGZBANEFUBDIS-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 192.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.55 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|