C18H17NO4S2 — CID 17413222
2-(2-oxochromen-7-yl)oxy-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]acetamide (PubChem CID 17413222) has the molecular formula C18H17NO4S2 and a molecular weight of 375.47 g/mol. Its IUPAC name is 2-(2-oxochromen-7-yl)oxy-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]acetamide.
| Compound Name | 2-(2-oxochromen-7-yl)oxy-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]acetamide |
|---|---|
| PubChem CID | 17413222 |
| Molecular Formula | C18H17NO4S2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 2-(2-oxochromen-7-yl)oxy-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]acetamide |
| SMILES | O=C(COc1ccc2ccc(=O)oc2c1)NCCSCc1ccsc1 |
| InChI | InChI=1S/C18H17NO4S2/c20-17(19-6-8-25-12-13-5-7-24-11-13)10-22-15-3-1-14-2-4-18(21)23-16(14)9-15/h1-5,7,9,11H,6,8,10,12H2,(H,19,20) |
| InChIKey | BSDWWRVDYIZJRV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|