C29H38N2O5S — CID 54566555
4-oxo-3-[[4-oxo-4-(2-phenylethylamino)-2-propan-2-ylbutanoyl]amino]-5-(3-phenylpropylsulfanyl)pentanoic acid (PubChem CID 54566555) has the molecular formula C29H38N2O5S and a molecular weight of 526.70 g/mol. Its IUPAC name is 4-oxo-3-[[4-oxo-4-(2-phenylethylamino)-2-propan-2-ylbutanoyl]amino]-5-(3-phenylpropylsulfanyl)pentanoic acid.
| Compound Name | 4-oxo-3-[[4-oxo-4-(2-phenylethylamino)-2-propan-2-ylbutanoyl]amino]-5-(3-phenylpropylsulfanyl)pentanoic acid |
|---|---|
| PubChem CID | 54566555 |
| Molecular Formula | C29H38N2O5S |
| Molecular Weight | 526.70 g/mol |
| Exact Mass | 526.25 |
| IUPAC Name | 4-oxo-3-[[4-oxo-4-(2-phenylethylamino)-2-propan-2-ylbutanoyl]amino]-5-(3-phenylpropylsulfanyl)pentanoic acid |
| SMILES | CC(C)C(CC(=O)NCCc1ccccc1)C(=O)NC(CC(=O)O)C(=O)CSCCCc1ccccc1 |
| InChI | InChI=1S/C29H38N2O5S/c1-21(2)24(18-27(33)30-16-15-23-12-7-4-8-13-23)29(36)31-25(19-28(34)35)26(32)20-37-17-9-14-22-10-5-3-6-11-22/h3-8,10-13,21,24-25H,9,14-20H2,1-2H3,(H,30,33)(H,31,36)(H,34,35) |
| InChIKey | ZUFPMJKQYAGYHR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.70 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|