C20H28N4O4S — CID 87601591
tert-butyl 4-[(2Z)-2-hydroxyimino-3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]propyl]piperazine-1-carboxylate (PubChem CID 87601591) has the molecular formula C20H28N4O4S and a molecular weight of 420.54 g/mol. Its IUPAC name is tert-butyl 4-[(2Z)-2-hydroxyimino-3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]propyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2Z)-2-hydroxyimino-3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 87601591 |
| Molecular Formula | C20H28N4O4S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | tert-butyl 4-[(2Z)-2-hydroxyimino-3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]propyl]piperazine-1-carboxylate |
| SMILES | Cc1nc2cc(OC/C(CN3CCN(C(=O)OC(C)(C)C)CC3)=N\O)ccc2s1 |
| InChI | InChI=1S/C20H28N4O4S/c1-14-21-17-11-16(5-6-18(17)29-14)27-13-15(22-26)12-23-7-9-24(10-8-23)19(25)28-20(2,3)4/h5-6,11,26H,7-10,12-13H2,1-4H3/b22-15- |
| InChIKey | AWTJLIRNFJVYBA-JCMHNJIXSA-N |
| XLogP | 3.37 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|