C14H13ClO3S2 — CID 87602305
S-[(2,4-dimethoxyphenyl)methyl] 5-chlorothiophene-2-carbothioate (PubChem CID 87602305) has the molecular formula C14H13ClO3S2 and a molecular weight of 328.84 g/mol. Its IUPAC name is S-[(2,4-dimethoxyphenyl)methyl] 5-chlorothiophene-2-carbothioate.
| Compound Name | S-[(2,4-dimethoxyphenyl)methyl] 5-chlorothiophene-2-carbothioate |
|---|---|
| PubChem CID | 87602305 |
| Molecular Formula | C14H13ClO3S2 |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | S-[(2,4-dimethoxyphenyl)methyl] 5-chlorothiophene-2-carbothioate |
| SMILES | COc1ccc(CSC(=O)c2ccc(Cl)s2)c(OC)c1 |
| InChI | InChI=1S/C14H13ClO3S2/c1-17-10-4-3-9(11(7-10)18-2)8-19-14(16)12-5-6-13(15)20-12/h3-7H,8H2,1-2H3 |
| InChIKey | ILAROKYJDCBZHJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|