C16H14F3NO2 — CID 87607522
methyl (2S)-2-amino-3-(2,3,6-trifluoro-4-phenylphenyl)propanoate (PubChem CID 87607522) has the molecular formula C16H14F3NO2 and a molecular weight of 309.29 g/mol. Its IUPAC name is methyl (2S)-2-amino-3-(2,3,6-trifluoro-4-phenylphenyl)propanoate.
| Compound Name | methyl (2S)-2-amino-3-(2,3,6-trifluoro-4-phenylphenyl)propanoate |
|---|---|
| PubChem CID | 87607522 |
| Molecular Formula | C16H14F3NO2 |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | methyl (2S)-2-amino-3-(2,3,6-trifluoro-4-phenylphenyl)propanoate |
| SMILES | COC(=O)[C@@H](N)Cc1c(F)cc(-c2ccccc2)c(F)c1F |
| InChI | InChI=1S/C16H14F3NO2/c1-22-16(21)13(20)8-11-12(17)7-10(14(18)15(11)19)9-5-3-2-4-6-9/h2-7,13H,8,20H2,1H3/t13-/m0/s1 |
| InChIKey | PCRWMWBOZKRAJE-ZDUSSCGKSA-N |
| XLogP | 2.81 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|