C19H26N2O5 — CID 87613011
tert-butyl (2R)-2-(1-amino-3-oxo-3-phenylmethoxypropyl)-6-oxa-3-azabicyclo[3.1.0]hexane-3-carboxylate (PubChem CID 87613011) has the molecular formula C19H26N2O5 and a molecular weight of 362.43 g/mol. Its IUPAC name is tert-butyl (2R)-2-(1-amino-3-oxo-3-phenylmethoxypropyl)-6-oxa-3-azabicyclo[3.1.0]hexane-3-carboxylate.
| Compound Name | tert-butyl (2R)-2-(1-amino-3-oxo-3-phenylmethoxypropyl)-6-oxa-3-azabicyclo[3.1.0]hexane-3-carboxylate |
|---|---|
| PubChem CID | 87613011 |
| Molecular Formula | C19H26N2O5 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | tert-butyl (2R)-2-(1-amino-3-oxo-3-phenylmethoxypropyl)-6-oxa-3-azabicyclo[3.1.0]hexane-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2OC2[C@H]1C(N)CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H26N2O5/c1-19(2,3)26-18(23)21-10-14-17(25-14)16(21)13(20)9-15(22)24-11-12-7-5-4-6-8-12/h4-8,13-14,16-17H,9-11,20H2,1-3H3/t13?,14?,16-,17?/m1/s1 |
| InChIKey | JZKBKXCTSDEUDW-DZTUWMGKSA-N |
| XLogP | 1.83 |
| TPSA | 94.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|