C22H24N2OS2 — CID 87615186
5-[[4-[(4-butyl-N-methylanilino)methyl]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 87615186) has the molecular formula C22H24N2OS2 and a molecular weight of 396.58 g/mol. Its IUPAC name is 5-[[4-[(4-butyl-N-methylanilino)methyl]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[4-[(4-butyl-N-methylanilino)methyl]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 87615186 |
| Molecular Formula | C22H24N2OS2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 5-[[4-[(4-butyl-N-methylanilino)methyl]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCCCc1ccc(N(C)Cc2ccc(C=C3SC(=S)NC3=O)cc2)cc1 |
| InChI | InChI=1S/C22H24N2OS2/c1-3-4-5-16-10-12-19(13-11-16)24(2)15-18-8-6-17(7-9-18)14-20-21(25)23-22(26)27-20/h6-14H,3-5,15H2,1-2H3,(H,23,25,26) |
| InChIKey | VEONWSYSYWVCLG-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|