C28H28F2N4O2 — CID 87616402
N-[(E)-[(3,4-difluorophenyl)-[4-(spiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-1'-ylmethyl)phenyl]methylidene]amino]-N-methylacetamide (PubChem CID 87616402) has the molecular formula C28H28F2N4O2 and a molecular weight of 490.55 g/mol. Its IUPAC name is N-[(E)-[(3,4-difluorophenyl)-[4-(spiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-1'-ylmethyl)phenyl]methylidene]amino]-N-methylacetamide.
| Compound Name | N-[(E)-[(3,4-difluorophenyl)-[4-(spiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-1'-ylmethyl)phenyl]methylidene]amino]-N-methylacetamide |
|---|---|
| PubChem CID | 87616402 |
| Molecular Formula | C28H28F2N4O2 |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | N-[(E)-[(3,4-difluorophenyl)-[4-(spiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-1'-ylmethyl)phenyl]methylidene]amino]-N-methylacetamide |
| SMILES | CC(=O)N(C)/N=C(\c1ccc(CN2CCC3(CC2)OCc2ccncc23)cc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C28H28F2N4O2/c1-19(35)33(2)32-27(22-7-8-25(29)26(30)15-22)21-5-3-20(4-6-21)17-34-13-10-28(11-14-34)24-16-31-12-9-23(24)18-36-28/h3-9,12,15-16H,10-11,13-14,17-18H2,1-2H3/b32-27+ |
| InChIKey | LRYCVEOHOHJBAF-QVAGMWBUSA-N |
| XLogP | 4.61 |
| TPSA | 58.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|