C28H27F2N5O3 — CID 91135668
3-[[(3,4-difluorophenyl)-[5-[(5-methyl-6-oxospiro[3H-furo[3,4-c]pyridine-1,4'-piperidine]-1'-yl)methyl]-2-pyridinyl]methylidene]amino]oxypropanenitrile (PubChem CID 91135668) has the molecular formula C28H27F2N5O3 and a molecular weight of 519.55 g/mol. Its IUPAC name is 3-[[(3,4-difluorophenyl)-[5-[(5-methyl-6-oxospiro[3H-furo[3,4-c]pyridine-1,4'-piperidine]-1'-yl)methyl]-2-pyridinyl]methylidene]amino]oxypropanenitrile.
| Compound Name | 3-[[(3,4-difluorophenyl)-[5-[(5-methyl-6-oxospiro[3H-furo[3,4-c]pyridine-1,4'-piperidine]-1'-yl)methyl]-2-pyridinyl]methylidene]amino]oxypropanenitrile |
|---|---|
| PubChem CID | 91135668 |
| Molecular Formula | C28H27F2N5O3 |
| Molecular Weight | 519.55 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | 3-[[(3,4-difluorophenyl)-[5-[(5-methyl-6-oxospiro[3H-furo[3,4-c]pyridine-1,4'-piperidine]-1'-yl)methyl]-2-pyridinyl]methylidene]amino]oxypropanenitrile |
| SMILES | Cn1cc2c(cc1=O)C1(CCN(Cc3ccc(C(=NOCCC#N)c4ccc(F)c(F)c4)nc3)CC1)OC2 |
| InChI | InChI=1S/C28H27F2N5O3/c1-34-17-21-18-37-28(22(21)14-26(34)36)7-10-35(11-8-28)16-19-3-6-25(32-15-19)27(33-38-12-2-9-31)20-4-5-23(29)24(30)13-20/h3-6,13-15,17H,2,7-8,10-12,16,18H2,1H3 |
| InChIKey | WZAJEHRTPSQAQR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 92.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.55 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|