C26H26F2N6O — CID 173082205
1-(3,4-difluorophenyl)-N-ethoxy-1-[5-[[4-([1,2,4]triazolo[1,5-a]pyridin-6-yl)piperidin-1-yl]methyl]-2-pyridinyl]methanimine (PubChem CID 173082205) has the molecular formula C26H26F2N6O and a molecular weight of 476.53 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-N-ethoxy-1-[5-[[4-([1,2,4]triazolo[1,5-a]pyridin-6-yl)piperidin-1-yl]methyl]-2-pyridinyl]methanimine.
| Compound Name | 1-(3,4-difluorophenyl)-N-ethoxy-1-[5-[[4-([1,2,4]triazolo[1,5-a]pyridin-6-yl)piperidin-1-yl]methyl]-2-pyridinyl]methanimine |
|---|---|
| PubChem CID | 173082205 |
| Molecular Formula | C26H26F2N6O |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 1-(3,4-difluorophenyl)-N-ethoxy-1-[5-[[4-([1,2,4]triazolo[1,5-a]pyridin-6-yl)piperidin-1-yl]methyl]-2-pyridinyl]methanimine |
| SMILES | CCON=C(c1ccc(F)c(F)c1)c1ccc(CN2CCC(c3ccc4ncnn4c3)CC2)cn1 |
| InChI | InChI=1S/C26H26F2N6O/c1-2-35-32-26(20-4-6-22(27)23(28)13-20)24-7-3-18(14-29-24)15-33-11-9-19(10-12-33)21-5-8-25-30-17-31-34(25)16-21/h3-8,13-14,16-17,19H,2,9-12,15H2,1H3 |
| InChIKey | CJJNACNHSZQHKX-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|