C26H26F3N5O — CID 44555859
(E)-1-(3,4-difluorophenyl)-N-ethoxy-1-[5-[[2-(6-fluoro-3-pyridinyl)-2,7-diazaspiro[3.4]octan-7-yl]methyl]-2-pyridinyl]methanimine (PubChem CID 44555859) has the molecular formula C26H26F3N5O and a molecular weight of 481.52 g/mol. Its IUPAC name is (E)-1-(3,4-difluorophenyl)-N-ethoxy-1-[5-[[2-(6-fluoro-3-pyridinyl)-2,7-diazaspiro[3.4]octan-7-yl]methyl]-2-pyridinyl]methanimine.
| Compound Name | (E)-1-(3,4-difluorophenyl)-N-ethoxy-1-[5-[[2-(6-fluoro-3-pyridinyl)-2,7-diazaspiro[3.4]octan-7-yl]methyl]-2-pyridinyl]methanimine |
|---|---|
| PubChem CID | 44555859 |
| Molecular Formula | C26H26F3N5O |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | (E)-1-(3,4-difluorophenyl)-N-ethoxy-1-[5-[[2-(6-fluoro-3-pyridinyl)-2,7-diazaspiro[3.4]octan-7-yl]methyl]-2-pyridinyl]methanimine |
| SMILES | CCO/N=C(\c1ccc(F)c(F)c1)c1ccc(CN2CCC3(C2)CN(c2ccc(F)nc2)C3)cn1 |
| InChI | InChI=1S/C26H26F3N5O/c1-2-35-32-25(19-4-6-21(27)22(28)11-19)23-7-3-18(12-30-23)14-33-10-9-26(15-33)16-34(17-26)20-5-8-24(29)31-13-20/h3-8,11-13H,2,9-10,14-17H2,1H3/b32-25+ |
| InChIKey | LAARUZREJRIKKS-WGPBWIAQSA-N |
| XLogP | 4.40 |
| TPSA | 53.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|