C24H24F2N6O — CID 123693313
1-(3,4-difluorophenyl)-N-ethoxy-1-[5-[(2-pyrimidin-5-yl-2,6-diazaspiro[3.3]heptan-6-yl)methyl]-2-pyridinyl]methanimine (PubChem CID 123693313) has the molecular formula C24H24F2N6O and a molecular weight of 450.49 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-N-ethoxy-1-[5-[(2-pyrimidin-5-yl-2,6-diazaspiro[3.3]heptan-6-yl)methyl]-2-pyridinyl]methanimine.
| Compound Name | 1-(3,4-difluorophenyl)-N-ethoxy-1-[5-[(2-pyrimidin-5-yl-2,6-diazaspiro[3.3]heptan-6-yl)methyl]-2-pyridinyl]methanimine |
|---|---|
| PubChem CID | 123693313 |
| Molecular Formula | C24H24F2N6O |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | 1-(3,4-difluorophenyl)-N-ethoxy-1-[5-[(2-pyrimidin-5-yl-2,6-diazaspiro[3.3]heptan-6-yl)methyl]-2-pyridinyl]methanimine |
| SMILES | CCON=C(c1ccc(F)c(F)c1)c1ccc(CN2CC3(C2)CN(c2cncnc2)C3)cn1 |
| InChI | InChI=1S/C24H24F2N6O/c1-2-33-30-23(18-4-5-20(25)21(26)7-18)22-6-3-17(8-29-22)11-31-12-24(13-31)14-32(15-24)19-9-27-16-28-10-19/h3-10,16H,2,11-15H2,1H3 |
| InChIKey | NVBFOBWPSVRFTH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 66.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|