C25H25F2N5O2 — CID 154041444
N-[5-[1-[[6-[C-(3,4-difluorophenyl)-N-hydroxycarbonimidoyl]-3-pyridinyl]methyl]piperidin-4-yl]-3-pyridinyl]acetamide (PubChem CID 154041444) has the molecular formula C25H25F2N5O2 and a molecular weight of 465.50 g/mol. Its IUPAC name is N-[5-[1-[[6-[C-(3,4-difluorophenyl)-N-hydroxycarbonimidoyl]-3-pyridinyl]methyl]piperidin-4-yl]-3-pyridinyl]acetamide.
| Compound Name | N-[5-[1-[[6-[C-(3,4-difluorophenyl)-N-hydroxycarbonimidoyl]-3-pyridinyl]methyl]piperidin-4-yl]-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 154041444 |
| Molecular Formula | C25H25F2N5O2 |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | N-[5-[1-[[6-[C-(3,4-difluorophenyl)-N-hydroxycarbonimidoyl]-3-pyridinyl]methyl]piperidin-4-yl]-3-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1cncc(C2CCN(Cc3ccc(C(=NO)c4ccc(F)c(F)c4)nc3)CC2)c1 |
| InChI | InChI=1S/C25H25F2N5O2/c1-16(33)30-21-10-20(13-28-14-21)18-6-8-32(9-7-18)15-17-2-5-24(29-12-17)25(31-34)19-3-4-22(26)23(27)11-19/h2-5,10-14,18,34H,6-9,15H2,1H3,(H,30,33) |
| InChIKey | XQNFSXGRGMJYLA-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|