C26H29FN4O2 — CID 173082330
5-[1-[[4-[N-ethoxy-C-(5-fluoro-2-pyridinyl)carbonimidoyl]phenyl]methyl]piperidin-4-yl]-1-methylpyridin-2-one (PubChem CID 173082330) has the molecular formula C26H29FN4O2 and a molecular weight of 448.54 g/mol. Its IUPAC name is 5-[1-[[4-[N-ethoxy-C-(5-fluoro-2-pyridinyl)carbonimidoyl]phenyl]methyl]piperidin-4-yl]-1-methylpyridin-2-one.
| Compound Name | 5-[1-[[4-[N-ethoxy-C-(5-fluoro-2-pyridinyl)carbonimidoyl]phenyl]methyl]piperidin-4-yl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 173082330 |
| Molecular Formula | C26H29FN4O2 |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | 5-[1-[[4-[N-ethoxy-C-(5-fluoro-2-pyridinyl)carbonimidoyl]phenyl]methyl]piperidin-4-yl]-1-methylpyridin-2-one |
| SMILES | CCON=C(c1ccc(CN2CCC(c3ccc(=O)n(C)c3)CC2)cc1)c1ccc(F)cn1 |
| InChI | InChI=1S/C26H29FN4O2/c1-3-33-29-26(24-10-9-23(27)16-28-24)21-6-4-19(5-7-21)17-31-14-12-20(13-15-31)22-8-11-25(32)30(2)18-22/h4-11,16,18,20H,3,12-15,17H2,1-2H3 |
| InChIKey | XHEJHEDWYRBDLT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|