C46H33Cl2F4N5O — CID 87617013
8-(2,6-dichlorophenyl)-4-(2,4-difluorophenyl)-2-piperidin-4-yl-1,7-naphthyridine;4-(2,4-difluorophenyl)-8-(2-methylphenyl)-7-oxido-1,7-naphthyridin-7-ium (PubChem CID 87617013) has the molecular formula C46H33Cl2F4N5O and a molecular weight of 818.70 g/mol. Its IUPAC name is 8-(2,6-dichlorophenyl)-4-(2,4-difluorophenyl)-2-piperidin-4-yl-1,7-naphthyridine;4-(2,4-difluorophenyl)-8-(2-methylphenyl)-7-oxido-1,7-naphthyridin-7-ium.
| Compound Name | 8-(2,6-dichlorophenyl)-4-(2,4-difluorophenyl)-2-piperidin-4-yl-1,7-naphthyridine;4-(2,4-difluorophenyl)-8-(2-methylphenyl)-7-oxido-1,7-naphthyridin-7-ium |
|---|---|
| PubChem CID | 87617013 |
| Molecular Formula | C46H33Cl2F4N5O |
| Molecular Weight | 818.70 g/mol |
| Exact Mass | 817.20 |
| IUPAC Name | 8-(2,6-dichlorophenyl)-4-(2,4-difluorophenyl)-2-piperidin-4-yl-1,7-naphthyridine;4-(2,4-difluorophenyl)-8-(2-methylphenyl)-7-oxido-1,7-naphthyridin-7-ium |
| SMILES | Cc1ccccc1-c1c2nccc(-c3ccc(F)cc3F)c2cc[n+]1[O-].Fc1ccc(-c2cc(C3CCNCC3)nc3c(-c4c(Cl)cccc4Cl)nccc23)c(F)c1 |
| InChI | InChI=1S/C25H19Cl2F2N3.C21H14F2N2O/c26-19-2-1-3-20(27)23(19)25-24-17(8-11-31-25)18(16-5-4-15(28)12-21(16)29)13-22(32-24)14-6-9-30-10-7-14;1-13-4-2-3-5-15(13)21-20-18(9-11-25(21)26)16(8-10-24-20)17-7-6-14(22)12-19(17)23/h1-5,8,11-14,30H,6-7,9-10H2;2-12H,1H3 |
| InChIKey | DPXGUUBJFUFEKJ-UHFFFAOYSA-N |
| XLogP | 11.80 |
| TPSA | 77.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.70 |
| LogP ≤ 5 | 11.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|