C31H38N2O5 — CID 87618963
2-[[(4R,4aR,7R,7aR,12bS)-3-(cyclopropylmethyl)-9-hydroxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-(3-phenylpropoxy)amino]acetic acid (PubChem CID 87618963) has the molecular formula C31H38N2O5 and a molecular weight of 518.65 g/mol. Its IUPAC name is 2-[[(4R,4aR,7R,7aR,12bS)-3-(cyclopropylmethyl)-9-hydroxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-(3-phenylpropoxy)amino]acetic acid.
| Compound Name | 2-[[(4R,4aR,7R,7aR,12bS)-3-(cyclopropylmethyl)-9-hydroxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-(3-phenylpropoxy)amino]acetic acid |
|---|---|
| PubChem CID | 87618963 |
| Molecular Formula | C31H38N2O5 |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.28 |
| IUPAC Name | 2-[[(4R,4aR,7R,7aR,12bS)-3-(cyclopropylmethyl)-9-hydroxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-(3-phenylpropoxy)amino]acetic acid |
| SMILES | O=C(O)CN(OCCCc1ccccc1)[C@@H]1CC[C@H]2[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3CC2CC2)[C@H]1O5 |
| InChI | InChI=1S/C31H38N2O5/c34-26-13-10-22-17-25-23-11-12-24(33(19-27(35)36)37-16-4-7-20-5-2-1-3-6-20)30-31(23,28(22)29(26)38-30)14-15-32(25)18-21-8-9-21/h1-3,5-6,10,13,21,23-25,30,34H,4,7-9,11-12,14-19H2,(H,35,36)/t23-,24+,25+,30-,31-/m0/s1 |
| InChIKey | KEORCJULNSBLRR-KYXQQXELSA-N |
| XLogP | 4.16 |
| TPSA | 82.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|