C16H28N2O4 — CID 87619758
methyl (3R,4R,5S)-5-amino-4-(3-oxopropylamino)-3-pentoxycyclohexene-1-carboxylate (PubChem CID 87619758) has the molecular formula C16H28N2O4 and a molecular weight of 312.41 g/mol. Its IUPAC name is methyl (3R,4R,5S)-5-amino-4-(3-oxopropylamino)-3-pentoxycyclohexene-1-carboxylate.
| Compound Name | methyl (3R,4R,5S)-5-amino-4-(3-oxopropylamino)-3-pentoxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 87619758 |
| Molecular Formula | C16H28N2O4 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | methyl (3R,4R,5S)-5-amino-4-(3-oxopropylamino)-3-pentoxycyclohexene-1-carboxylate |
| SMILES | CCCCCO[C@@H]1C=C(C(=O)OC)C[C@H](N)[C@H]1NCCC=O |
| InChI | InChI=1S/C16H28N2O4/c1-3-4-5-9-22-14-11-12(16(20)21-2)10-13(17)15(14)18-7-6-8-19/h8,11,13-15,18H,3-7,9-10,17H2,1-2H3/t13-,14+,15+/m0/s1 |
| InChIKey | GZOVXNNHEBSQMB-RRFJBIMHSA-N |
| XLogP | 0.94 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|