C19H41NO3 — CID 155704328
ethane;methanol;(4R)-4-methoxy-N-methyl-3-pentoxycyclohepta-1,5-dien-1-amine (PubChem CID 155704328) has the molecular formula C19H41NO3 and a molecular weight of 331.54 g/mol. Its IUPAC name is ethane;methanol;(4R)-4-methoxy-N-methyl-3-pentoxycyclohepta-1,5-dien-1-amine.
| Compound Name | ethane;methanol;(4R)-4-methoxy-N-methyl-3-pentoxycyclohepta-1,5-dien-1-amine |
|---|---|
| PubChem CID | 155704328 |
| Molecular Formula | C19H41NO3 |
| Molecular Weight | 331.54 g/mol |
| Exact Mass | 331.31 |
| IUPAC Name | ethane;methanol;(4R)-4-methoxy-N-methyl-3-pentoxycyclohepta-1,5-dien-1-amine |
| SMILES | CC.CC.CCCCCOC1C=C(NC)CC=C[C@H]1OC.CO |
| InChI | InChI=1S/C14H25NO2.2C2H6.CH4O/c1-4-5-6-10-17-14-11-12(15-2)8-7-9-13(14)16-3;3*1-2/h7,9,11,13-15H,4-6,8,10H2,1-3H3;2*1-2H3;2H,1H3/t13-,14?;;;/m1.../s1 |
| InChIKey | MOGTYQRFSCZZHF-NSFYLPGLSA-N |
| XLogP | 4.30 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.54 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|