C32H36NO4S+ — CID 87623365
[3,5-dimethyl-4-[2-[(4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbonyl)amino]ethoxy]phenyl]-diphenylsulfanium (PubChem CID 87623365) has the molecular formula C32H36NO4S+ and a molecular weight of 530.71 g/mol. Its IUPAC name is [3,5-dimethyl-4-[2-[(4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbonyl)amino]ethoxy]phenyl]-diphenylsulfanium.
| Compound Name | [3,5-dimethyl-4-[2-[(4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbonyl)amino]ethoxy]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 87623365 |
| Molecular Formula | C32H36NO4S+ |
| Molecular Weight | 530.71 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | [3,5-dimethyl-4-[2-[(4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbonyl)amino]ethoxy]phenyl]-diphenylsulfanium |
| SMILES | Cc1cc([S+](c2ccccc2)c2ccccc2)cc(C)c1OCCNC(=O)C12CCC(C)(C(=O)O1)C2(C)C |
| InChI | InChI=1S/C32H35NO4S/c1-22-20-26(38(24-12-8-6-9-13-24)25-14-10-7-11-15-25)21-23(2)27(22)36-19-18-33-28(34)32-17-16-31(5,29(35)37-32)30(32,3)4/h6-15,20-21H,16-19H2,1-5H3/p+1 |
| InChIKey | KVOHTVSGAPFMDE-UHFFFAOYSA-O |
| XLogP | 6.02 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.71 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|