C13H10Cl2N2O2S — CID 87626128
methyl [3-[(2,6-dichloro-4-pyridinyl)amino]phenyl]sulfanylformate (PubChem CID 87626128) has the molecular formula C13H10Cl2N2O2S and a molecular weight of 329.21 g/mol. Its IUPAC name is methyl [3-[(2,6-dichloro-4-pyridinyl)amino]phenyl]sulfanylformate.
| Compound Name | methyl [3-[(2,6-dichloro-4-pyridinyl)amino]phenyl]sulfanylformate |
|---|---|
| PubChem CID | 87626128 |
| Molecular Formula | C13H10Cl2N2O2S |
| Molecular Weight | 329.21 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | methyl [3-[(2,6-dichloro-4-pyridinyl)amino]phenyl]sulfanylformate |
| SMILES | COC(=O)Sc1cccc(Nc2cc(Cl)nc(Cl)c2)c1 |
| InChI | InChI=1S/C13H10Cl2N2O2S/c1-19-13(18)20-10-4-2-3-8(5-10)16-9-6-11(14)17-12(15)7-9/h2-7H,1H3,(H,16,17) |
| InChIKey | SENRJGNJKBPTAG-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.21 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|