C10H6Cl2N2O2 — CID 87627489
methyl 4,6-dichloroquinazoline-7-carboxylate (PubChem CID 87627489) has the molecular formula C10H6Cl2N2O2 and a molecular weight of 257.08 g/mol. Its IUPAC name is methyl 4,6-dichloroquinazoline-7-carboxylate.
| Compound Name | methyl 4,6-dichloroquinazoline-7-carboxylate |
|---|---|
| PubChem CID | 87627489 |
| Molecular Formula | C10H6Cl2N2O2 |
| Molecular Weight | 257.08 g/mol |
| Exact Mass | 255.98 |
| IUPAC Name | methyl 4,6-dichloroquinazoline-7-carboxylate |
| SMILES | COC(=O)c1cc2ncnc(Cl)c2cc1Cl |
| InChI | InChI=1S/C10H6Cl2N2O2/c1-16-10(15)5-3-8-6(2-7(5)11)9(12)14-4-13-8/h2-4H,1H3 |
| InChIKey | ZKQVCETWHMLSCA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.08 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |