C12H11ClN2O4 — CID 171864805
methyl 3-(4-chloroquinazolin-7-yl)-2,3-dihydroxypropanoate (PubChem CID 171864805) has the molecular formula C12H11ClN2O4 and a molecular weight of 282.68 g/mol. Its IUPAC name is methyl 3-(4-chloroquinazolin-7-yl)-2,3-dihydroxypropanoate.
| Compound Name | methyl 3-(4-chloroquinazolin-7-yl)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 171864805 |
| Molecular Formula | C12H11ClN2O4 |
| Molecular Weight | 282.68 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | methyl 3-(4-chloroquinazolin-7-yl)-2,3-dihydroxypropanoate |
| SMILES | COC(=O)C(O)C(O)c1ccc2c(Cl)ncnc2c1 |
| InChI | InChI=1S/C12H11ClN2O4/c1-19-12(18)10(17)9(16)6-2-3-7-8(4-6)14-5-15-11(7)13/h2-5,9-10,16-17H,1H3 |
| InChIKey | WUNPRHOUOULHKY-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 92.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.68 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |