C24H23ClN6O — CID 87629883
6-chloro-N-[4-[[[6,8-dimethyl-2-(methylamino)quinazolin-4-yl]amino]methyl]phenyl]pyridine-3-carboxamide (PubChem CID 87629883) has the molecular formula C24H23ClN6O and a molecular weight of 446.94 g/mol. Its IUPAC name is 6-chloro-N-[4-[[[6,8-dimethyl-2-(methylamino)quinazolin-4-yl]amino]methyl]phenyl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[4-[[[6,8-dimethyl-2-(methylamino)quinazolin-4-yl]amino]methyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 87629883 |
| Molecular Formula | C24H23ClN6O |
| Molecular Weight | 446.94 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 6-chloro-N-[4-[[[6,8-dimethyl-2-(methylamino)quinazolin-4-yl]amino]methyl]phenyl]pyridine-3-carboxamide |
| SMILES | CNc1nc(NCc2ccc(NC(=O)c3ccc(Cl)nc3)cc2)c2cc(C)cc(C)c2n1 |
| InChI | InChI=1S/C24H23ClN6O/c1-14-10-15(2)21-19(11-14)22(31-24(26-3)30-21)28-12-16-4-7-18(8-5-16)29-23(32)17-6-9-20(25)27-13-17/h4-11,13H,12H2,1-3H3,(H,29,32)(H2,26,28,30,31) |
| InChIKey | WXERZXUWPZGDIH-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.94 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|