C74H42O8 — CID 87632403
1,2-bis[4-[2-[2-[3,5-bis(2-phenylethynyl)phenyl]-2-oxoacetyl]phenoxy]phenyl]ethane-1,2-dione (PubChem CID 87632403) has the molecular formula C74H42O8 and a molecular weight of 1059.14 g/mol. Its IUPAC name is 1,2-bis[4-[2-[2-[3,5-bis(2-phenylethynyl)phenyl]-2-oxoacetyl]phenoxy]phenyl]ethane-1,2-dione.
| Compound Name | 1,2-bis[4-[2-[2-[3,5-bis(2-phenylethynyl)phenyl]-2-oxoacetyl]phenoxy]phenyl]ethane-1,2-dione |
|---|---|
| PubChem CID | 87632403 |
| Molecular Formula | C74H42O8 |
| Molecular Weight | 1059.14 g/mol |
| Exact Mass | 1058.29 |
| IUPAC Name | 1,2-bis[4-[2-[2-[3,5-bis(2-phenylethynyl)phenyl]-2-oxoacetyl]phenoxy]phenyl]ethane-1,2-dione |
| SMILES | O=C(C(=O)c1ccc(Oc2ccccc2C(=O)C(=O)c2cc(C#Cc3ccccc3)cc(C#Cc3ccccc3)c2)cc1)c1ccc(Oc2ccccc2C(=O)C(=O)c2cc(C#Cc3ccccc3)cc(C#Cc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C74H42O8/c75-69(59-37-41-63(42-38-59)81-67-27-15-13-25-65(67)73(79)71(77)61-47-55(33-29-51-17-5-1-6-18-51)45-56(48-61)34-30-52-19-7-2-8-20-52)70(76)60-39-43-64(44-40-60)82-68-28-16-14-26-66(68)74(80)72(78)62-49-57(35-31-53-21-9-3-10-22-53)46-58(50-62)36-32-54-23-11-4-12-24-54/h1-28,37-50H |
| InChIKey | JPELTGHDFYIJLQ-UHFFFAOYSA-N |
| XLogP | 14.07 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1059.14 |
| LogP ≤ 5 | 14.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|