C25H30AsClN5O — CID 87634804
CID 87634804 (PubChem CID 87634804) has the molecular formula C25H30AsClN5O and a molecular weight of 526.92 g/mol.
| Compound Name | CID 87634804 |
|---|---|
| PubChem CID | 87634804 |
| Molecular Formula | C25H30AsClN5O |
| Molecular Weight | 526.92 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | — |
| SMILES | Cc1cccc(Cl)c1NC(=O)NCC1CCC([As]c2nc(N(C)C)c3ccccc3n2)CC1 |
| InChI | InChI=1S/C25H30AsClN5O/c1-16-7-6-9-20(27)22(16)30-25(33)28-15-17-11-13-18(14-12-17)26-24-29-21-10-5-4-8-19(21)23(31-24)32(2)3/h4-10,17-18H,11-15H2,1-3H3,(H2,28,30,33) |
| InChIKey | LZOOMIZXNSPRIF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.92 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|