C21H32O7 — CID 87636104
butyl prop-2-enoate;methyl 2-methylprop-2-enoate;oxiran-2-ylmethyl cyclopentene-1-carboxylate (PubChem CID 87636104) has the molecular formula C21H32O7 and a molecular weight of 396.48 g/mol. Its IUPAC name is butyl prop-2-enoate;methyl 2-methylprop-2-enoate;oxiran-2-ylmethyl cyclopentene-1-carboxylate.
| Compound Name | butyl prop-2-enoate;methyl 2-methylprop-2-enoate;oxiran-2-ylmethyl cyclopentene-1-carboxylate |
|---|---|
| PubChem CID | 87636104 |
| Molecular Formula | C21H32O7 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | butyl prop-2-enoate;methyl 2-methylprop-2-enoate;oxiran-2-ylmethyl cyclopentene-1-carboxylate |
| SMILES | C=C(C)C(=O)OC.C=CC(=O)OCCCC.O=C(OCC1CO1)C1=CCCC1 |
| InChI | InChI=1S/C9H12O3.C7H12O2.C5H8O2/c10-9(7-3-1-2-4-7)12-6-8-5-11-8;1-3-5-6-9-7(8)4-2;1-4(2)5(6)7-3/h3,8H,1-2,4-6H2;4H,2-3,5-6H2,1H3;1H2,2-3H3 |
| InChIKey | MDDHUWLBODTPMF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 91.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|