C42H30N9O4PS3 — CID 87639294
tris[3-[(4-pyridin-4-yl-1,3-thiazol-2-yl)amino]phenyl] phosphate (PubChem CID 87639294) has the molecular formula C42H30N9O4PS3 and a molecular weight of 851.94 g/mol. Its IUPAC name is tris[3-[(4-pyridin-4-yl-1,3-thiazol-2-yl)amino]phenyl] phosphate.
| Compound Name | tris[3-[(4-pyridin-4-yl-1,3-thiazol-2-yl)amino]phenyl] phosphate |
|---|---|
| PubChem CID | 87639294 |
| Molecular Formula | C42H30N9O4PS3 |
| Molecular Weight | 851.94 g/mol |
| Exact Mass | 851.13 |
| IUPAC Name | tris[3-[(4-pyridin-4-yl-1,3-thiazol-2-yl)amino]phenyl] phosphate |
| SMILES | O=P(Oc1cccc(Nc2nc(-c3ccncc3)cs2)c1)(Oc1cccc(Nc2nc(-c3ccncc3)cs2)c1)Oc1cccc(Nc2nc(-c3ccncc3)cs2)c1 |
| InChI | InChI=1S/C42H30N9O4PS3/c52-56(53-34-7-1-4-31(22-34)46-40-49-37(25-57-40)28-10-16-43-17-11-28,54-35-8-2-5-32(23-35)47-41-50-38(26-58-41)29-12-18-44-19-13-29)55-36-9-3-6-33(24-36)48-42-51-39(27-59-42)30-14-20-45-21-15-30/h1-27H,(H,46,49)(H,47,50)(H,48,51) |
| InChIKey | ODENYBDXUAXBCI-UHFFFAOYSA-N |
| XLogP | 12.12 |
| TPSA | 158.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.94 |
| LogP ≤ 5 | 12.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|