C23H24N4O3S — CID 87640899
4-[2-(dimethylamino)ethoxy]-N-[3-[4-(hydroxycarbamothioyl)phenyl]prop-2-ynyl]-1H-indole-2-carboxamide (PubChem CID 87640899) has the molecular formula C23H24N4O3S and a molecular weight of 436.54 g/mol. Its IUPAC name is 4-[2-(dimethylamino)ethoxy]-N-[3-[4-(hydroxycarbamothioyl)phenyl]prop-2-ynyl]-1H-indole-2-carboxamide.
| Compound Name | 4-[2-(dimethylamino)ethoxy]-N-[3-[4-(hydroxycarbamothioyl)phenyl]prop-2-ynyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 87640899 |
| Molecular Formula | C23H24N4O3S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 4-[2-(dimethylamino)ethoxy]-N-[3-[4-(hydroxycarbamothioyl)phenyl]prop-2-ynyl]-1H-indole-2-carboxamide |
| SMILES | CN(C)CCOc1cccc2[nH]c(C(=O)NCC#Cc3ccc(C(=S)NO)cc3)cc12 |
| InChI | InChI=1S/C23H24N4O3S/c1-27(2)13-14-30-21-7-3-6-19-18(21)15-20(25-19)22(28)24-12-4-5-16-8-10-17(11-9-16)23(31)26-29/h3,6-11,15,25,29H,12-14H2,1-2H3,(H,24,28)(H,26,31) |
| InChIKey | DEWQVNHNSUUTSE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|