C24H26N4O4 — CID 89380202
5-[2-(dimethylamino)ethoxy]-N-[3-[4-(methoxycarbamoyl)phenyl]prop-2-ynyl]-1H-indole-2-carboxamide (PubChem CID 89380202) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is 5-[2-(dimethylamino)ethoxy]-N-[3-[4-(methoxycarbamoyl)phenyl]prop-2-ynyl]-1H-indole-2-carboxamide.
| Compound Name | 5-[2-(dimethylamino)ethoxy]-N-[3-[4-(methoxycarbamoyl)phenyl]prop-2-ynyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 89380202 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 5-[2-(dimethylamino)ethoxy]-N-[3-[4-(methoxycarbamoyl)phenyl]prop-2-ynyl]-1H-indole-2-carboxamide |
| SMILES | CONC(=O)c1ccc(C#CCNC(=O)c2cc3cc(OCCN(C)C)ccc3[nH]2)cc1 |
| InChI | InChI=1S/C24H26N4O4/c1-28(2)13-14-32-20-10-11-21-19(15-20)16-22(26-21)24(30)25-12-4-5-17-6-8-18(9-7-17)23(29)27-31-3/h6-11,15-16,26H,12-14H2,1-3H3,(H,25,30)(H,27,29) |
| InChIKey | XUPBMCPHTQVZJP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|