C30H41N5O6 — CID 129076593
2-[2-[(4-aminobenzoyl)amino]ethoxy]ethyl N-[2-[2-[[2-(2,2-dimethylpropanoyl)-1H-indol-5-yl]oxy]ethyl-methylamino]ethyl]carbamate (PubChem CID 129076593) has the molecular formula C30H41N5O6 and a molecular weight of 567.69 g/mol. Its IUPAC name is 2-[2-[(4-aminobenzoyl)amino]ethoxy]ethyl N-[2-[2-[[2-(2,2-dimethylpropanoyl)-1H-indol-5-yl]oxy]ethyl-methylamino]ethyl]carbamate.
| Compound Name | 2-[2-[(4-aminobenzoyl)amino]ethoxy]ethyl N-[2-[2-[[2-(2,2-dimethylpropanoyl)-1H-indol-5-yl]oxy]ethyl-methylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 129076593 |
| Molecular Formula | C30H41N5O6 |
| Molecular Weight | 567.69 g/mol |
| Exact Mass | 567.31 |
| IUPAC Name | 2-[2-[(4-aminobenzoyl)amino]ethoxy]ethyl N-[2-[2-[[2-(2,2-dimethylpropanoyl)-1H-indol-5-yl]oxy]ethyl-methylamino]ethyl]carbamate |
| SMILES | CN(CCNC(=O)OCCOCCNC(=O)c1ccc(N)cc1)CCOc1ccc2[nH]c(C(=O)C(C)(C)C)cc2c1 |
| InChI | InChI=1S/C30H41N5O6/c1-30(2,3)27(36)26-20-22-19-24(9-10-25(22)34-26)40-16-14-35(4)13-11-33-29(38)41-18-17-39-15-12-32-28(37)21-5-7-23(31)8-6-21/h5-10,19-20,34H,11-18,31H2,1-4H3,(H,32,37)(H,33,38) |
| InChIKey | QGMZSKLNZODUFQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 148.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.69 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|