C10H16O7 — CID 87643984
[(2R,3R,4S)-2,3,4,6-tetrahydroxy-5-oxohexyl] 2-methylprop-2-enoate (PubChem CID 87643984) has the molecular formula C10H16O7 and a molecular weight of 248.23 g/mol. Its IUPAC name is [(2R,3R,4S)-2,3,4,6-tetrahydroxy-5-oxohexyl] 2-methylprop-2-enoate.
| Compound Name | [(2R,3R,4S)-2,3,4,6-tetrahydroxy-5-oxohexyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87643984 |
| Molecular Formula | C10H16O7 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | [(2R,3R,4S)-2,3,4,6-tetrahydroxy-5-oxohexyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC[C@@H](O)[C@@H](O)[C@H](O)C(=O)CO |
| InChI | InChI=1S/C10H16O7/c1-5(2)10(16)17-4-7(13)9(15)8(14)6(12)3-11/h7-9,11,13-15H,1,3-4H2,2H3/t7-,8-,9-/m1/s1 |
| InChIKey | KATMFAXKCYMPOL-IWSPIJDZSA-N |
| XLogP | -2.25 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|