C12H20O8 — CID 155663811
[(4S,5S,6R,7R)-1-deuterio-4,5,6,7,8-pentahydroxy-3-oxooctyl] 2-methylprop-2-enoate (PubChem CID 155663811) has the molecular formula C12H20O8 and a molecular weight of 293.29 g/mol. Its IUPAC name is [(4S,5S,6R,7R)-1-deuterio-4,5,6,7,8-pentahydroxy-3-oxooctyl] 2-methylprop-2-enoate.
| Compound Name | [(4S,5S,6R,7R)-1-deuterio-4,5,6,7,8-pentahydroxy-3-oxooctyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155663811 |
| Molecular Formula | C12H20O8 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | [(4S,5S,6R,7R)-1-deuterio-4,5,6,7,8-pentahydroxy-3-oxooctyl] 2-methylprop-2-enoate |
| SMILES | [2H]C(CC(=O)[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)OC(=O)C(=C)C |
| InChI | InChI=1S/C12H20O8/c1-6(2)12(19)20-4-3-7(14)9(16)11(18)10(17)8(15)5-13/h8-11,13,15-18H,1,3-5H2,2H3/t8-,9-,10-,11-/m1/s1/i4D/t4?,8-,9-,10-,11- |
| InChIKey | CXMFKFPMMHFLBS-ITXZTHKZSA-N |
| XLogP | -2.50 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|