C10H21NO6 — CID 140968253
(4R,5S,6R,7R)-1-(dimethylamino)-4,5,6,7,8-pentahydroxyoctan-3-one (PubChem CID 140968253) has the molecular formula C10H21NO6 and a molecular weight of 251.28 g/mol. Its IUPAC name is (4R,5S,6R,7R)-1-(dimethylamino)-4,5,6,7,8-pentahydroxyoctan-3-one.
| Compound Name | (4R,5S,6R,7R)-1-(dimethylamino)-4,5,6,7,8-pentahydroxyoctan-3-one |
|---|---|
| PubChem CID | 140968253 |
| Molecular Formula | C10H21NO6 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | (4R,5S,6R,7R)-1-(dimethylamino)-4,5,6,7,8-pentahydroxyoctan-3-one |
| SMILES | CN(C)CCC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H21NO6/c1-11(2)4-3-6(13)8(15)10(17)9(16)7(14)5-12/h7-10,12,14-17H,3-5H2,1-2H3/t7-,8+,9-,10-/m1/s1 |
| InChIKey | ZHAOUPUPKKIWST-UTINFBMNSA-N |
| XLogP | -3.06 |
| TPSA | 121.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | -3.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |