C17H30N2O10 — CID 102267142
2-[4-[[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]butylcarbamoyloxy]ethyl 2-methylprop-2-enoate (PubChem CID 102267142) has the molecular formula C17H30N2O10 and a molecular weight of 422.43 g/mol. Its IUPAC name is 2-[4-[[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]butylcarbamoyloxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-[[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]butylcarbamoyloxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 102267142 |
| Molecular Formula | C17H30N2O10 |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 2-[4-[[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]butylcarbamoyloxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)NCCCCNC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C17H30N2O10/c1-10(2)16(26)28-7-8-29-17(27)19-6-4-3-5-18-15(25)14(24)13(23)12(22)11(21)9-20/h11-14,20-24H,1,3-9H2,2H3,(H,18,25)(H,19,27)/t11-,12-,13+,14-/m1/s1 |
| InChIKey | ZELFNYXXZYJTCX-YIYPIFLZSA-N |
| XLogP | -2.84 |
| TPSA | 194.88 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | -2.84 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|