C14H24FN3O7 — CID 87647598
acetyl fluoride;(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]propanoyl]amino]butanedioic acid (PubChem CID 87647598) has the molecular formula C14H24FN3O7 and a molecular weight of 365.36 g/mol. Its IUPAC name is acetyl fluoride;(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]propanoyl]amino]butanedioic acid.
| Compound Name | acetyl fluoride;(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]propanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 87647598 |
| Molecular Formula | C14H24FN3O7 |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | acetyl fluoride;(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]propanoyl]amino]butanedioic acid |
| SMILES | CC(=O)F.CC(C)[C@H](N)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H21N3O6.C2H3FO/c1-5(2)9(13)11(19)14-6(3)10(18)15-7(12(20)21)4-8(16)17;1-2(3)4/h5-7,9H,4,13H2,1-3H3,(H,14,19)(H,15,18)(H,16,17)(H,20,21);1H3/t6-,7-,9-;/m0./s1 |
| InChIKey | JNXPDIVHDAQEMD-UFLZEWODSA-N |
| XLogP | -0.98 |
| TPSA | 175.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|