C15H15N3O6S — CID 87649173
2-[[2-hydroxy-4-[(5-methylsulfonyl-2-pyridinyl)oxy]phenyl]hydrazinylidene]propanoic acid (PubChem CID 87649173) has the molecular formula C15H15N3O6S and a molecular weight of 365.37 g/mol. Its IUPAC name is 2-[[2-hydroxy-4-[(5-methylsulfonyl-2-pyridinyl)oxy]phenyl]hydrazinylidene]propanoic acid.
| Compound Name | 2-[[2-hydroxy-4-[(5-methylsulfonyl-2-pyridinyl)oxy]phenyl]hydrazinylidene]propanoic acid |
|---|---|
| PubChem CID | 87649173 |
| Molecular Formula | C15H15N3O6S |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 2-[[2-hydroxy-4-[(5-methylsulfonyl-2-pyridinyl)oxy]phenyl]hydrazinylidene]propanoic acid |
| SMILES | CC(=NNc1ccc(Oc2ccc(S(C)(=O)=O)cn2)cc1O)C(=O)O |
| InChI | InChI=1S/C15H15N3O6S/c1-9(15(20)21)17-18-12-5-3-10(7-13(12)19)24-14-6-4-11(8-16-14)25(2,22)23/h3-8,18-19H,1-2H3,(H,20,21) |
| InChIKey | DMTOYWMXTKMZHX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 138.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|