C12H18ClNO6S2 — CID 87650139
[(2R,3S)-2-[(4-chlorophenyl)sulfonylamino]-3-methylpentyl] sulfate;hydron (PubChem CID 87650139) has the molecular formula C12H18ClNO6S2 and a molecular weight of 371.86 g/mol. Its IUPAC name is [(2R,3S)-2-[(4-chlorophenyl)sulfonylamino]-3-methylpentyl] sulfate;hydron.
| Compound Name | [(2R,3S)-2-[(4-chlorophenyl)sulfonylamino]-3-methylpentyl] sulfate;hydron |
|---|---|
| PubChem CID | 87650139 |
| Molecular Formula | C12H18ClNO6S2 |
| Molecular Weight | 371.86 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | [(2R,3S)-2-[(4-chlorophenyl)sulfonylamino]-3-methylpentyl] sulfate;hydron |
| SMILES | CC[C@H](C)[C@H](COS(=O)(=O)[O-])NS(=O)(=O)c1ccc(Cl)cc1.[H+] |
| InChI | InChI=1S/C12H18ClNO6S2/c1-3-9(2)12(8-20-22(17,18)19)14-21(15,16)11-6-4-10(13)5-7-11/h4-7,9,12,14H,3,8H2,1-2H3,(H,17,18,19)/t9-,12-/m0/s1 |
| InChIKey | NGSXJEKULMRLSD-CABZTGNLSA-N |
| XLogP | 1.62 |
| TPSA | 112.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.86 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|